ethyl (Z)-octadec-9-enoate


ethyl (Z)-octadec-9-enoate; ethyl oleate; oleic acid ethyl ester
Links:📏 NIST, 📖 PubMed
CAS RN:[111-62-6]
Formula:C20H38O2; 310.52 g/mol
InChiKey:LVGKNOAMLMIIKO-QXMHVHEDSA-N
SMILES:CCCCCCCCC=C/CCCCCCCC(=O)OCC
Molecular structure of ethyl (Z)-octadec-9-enoate
Density:0.870 g/mL
Molar volume:356.9 mL/mol
Refractive index:1.452
Molecular refractive power:96.27 mL/mol
Dielectric constant:3.17
Melting point:-32 °C
Boiling point:207 °C

Isomers

ethenyl octadecanoate
Molecular structure of ethenyl octadecanoate
ethyl (E)-octadec-9-enoate
Molecular structure of ethyl (E)-octadec-9-enoate
ethyl (Z)-octadec-9-enoate
Molecular structure of ethyl (Z)-octadec-9-enoate
hexadecyl 2-methylprop-2-enoate
Molecular structure of hexadecyl 2-methylprop-2-enoate
(Z)-icos-11-enoic acid
Molecular structure of (Z)-icos-11-enoic acid
(13Z)-icos-13-enoic acid
Molecular structure of (13Z)-icos-13-enoic acid
(Z)-icos-9-enoic acid
Molecular structure of (Z)-icos-9-enoic acid